|
CAS#: 918-51-4 Product: 2-Bromo-2,2-dinitroethanol No suppilers available for the product. |
| Name | 2-Bromo-2,2-dinitroethanol |
|---|---|
| Synonyms | 2-Bromo-2,2-Dinitro-Ethanol; Brn 1777631; Ethanol, 2-Bromo-2,2-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C2H3BrN2O5 |
| Molecular Weight | 214.96 |
| CAS Registry Number | 918-51-4 |
| SMILES | C(O)C(Br)([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C2H3BrN2O5/c3-2(1-6,4(7)8)5(9)10/h6H,1H2 |
| InChIKey | KFEDHKQISIBCJO-UHFFFAOYSA-N |
| Density | 2.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.284°C at 760 mmHg (Cal.) |
| Flash point | 93.073°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-2,2-dinitroethanol |