|
CAS#: 919119-69-0 Product: 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole No suppilers available for the product. |
| Name | 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| Synonyms | 5-(4,4,5, |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22BNO2 |
| Molecular Weight | 283.17 |
| CAS Registry Number | 919119-69-0 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2[nH]c4c3CCC4 |
| InChI | 1S/C17H22BNO2/c1-16(2)17(3,4)21-18(20-16)13-9-5-8-12-11-7-6-10-14(11)19-15(12)13/h5,8-9,19H,6-7,10H2,1-4H3 |
| InChIKey | JHDZJIMZUXUIDY-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 215.4±27.3°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole |