|
CAS#: 92288-54-5 Product: 5-Ethyl-5-Phenyloxazolidinedione No suppilers available for the product. |
| Name | 5-Ethyl-5-Phenyloxazolidinedione |
|---|---|
| Synonyms | Sodium 5-Ethyl-4-Oxo-5-Phenyl-1,3-Oxazol-2-Olate; Sodium 5-Ethyl-4-Oxo-5-Phenyl-Oxazol-2-Olate; Sodium 5-Ethyl-5-Phenyl-Oxazolidin-3-Ide-2,4-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10NNaO3 |
| Molecular Weight | 227.19 |
| CAS Registry Number | 92288-54-5 |
| SMILES | [N-]1C(=O)C(OC1=O)(C2=CC=CC=C2)CC.[Na+] |
| InChI | 1S/C11H11NO3.Na/c1-2-11(8-6-4-3-5-7-8)9(13)12-10(14)15-11;/h3-7H,2H2,1H3,(H,12,13,14);/q;+1/p-1 |
| InChIKey | MATCWAFODDJQNN-UHFFFAOYSA-M |
| Boiling point | 333.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-5-Phenyloxazolidinedione |