|
CAS#: 92352-08-4 Product: (2-Aminopropanoylamino)-Bis(2-Chloroethyl)Azanium Bromide No suppilers available for the product. |
| Name | (2-Aminopropanoylamino)-Bis(2-Chloroethyl)Azanium Bromide |
|---|---|
| Synonyms | (2-Aminopropanoylamino)-Bis(2-Chloroethyl)Ammonium Bromide; [(2-Amino-1-Oxopropyl)Amino]-Bis(2-Chloroethyl)Ammonium Bromide; (Alanylamino)-Bis(2-Chloroethyl)Ammonium Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H16BrCl2N3O |
| Molecular Weight | 309.03 |
| CAS Registry Number | 92352-08-4 |
| SMILES | C([NH+](NC(C(C)N)=O)CCCl)CCl.[Br-] |
| InChI | 1S/C7H15Cl2N3O.BrH/c1-6(10)7(13)11-12(4-2-8)5-3-9;/h6H,2-5,10H2,1H3,(H,11,13);1H |
| InChIKey | QZFFLGQAFRHKRY-UHFFFAOYSA-N |
| Boiling point | 348.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 164.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Aminopropanoylamino)-Bis(2-Chloroethyl)Azanium Bromide |