|
CAS#: 924-59-4 Product: Diethyl-3-methylglutaconate No suppilers available for the product. |
| Name | Diethyl-3-methylglutaconate |
|---|---|
| Synonyms | (Z)-3-Methylpent-2-Enedioic Acid Diethyl Ester; Nsc75591 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 |
| CAS Registry Number | 924-59-4 |
| SMILES | C(C)OC(C\C(=C/C(=O)OCC)C)=O |
| InChI | 1S/C10H16O4/c1-4-13-9(11)6-8(3)7-10(12)14-5-2/h6H,4-5,7H2,1-3H3/b8-6- |
| InChIKey | ZKOYUECOZRNJDN-VURMDHGXSA-N |
| Density | 1.032g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.366°C at 760 mmHg (Cal.) |
| Flash point | 115.186°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl-3-methylglutaconate |