|
CAS#: 93404-61-6 Product: 6-Acetamido-7-Methoxy-5,8-Quinolinedione No suppilers available for the product. |
| Name | 6-Acetamido-7-Methoxy-5,8-Quinolinedione |
|---|---|
| Synonyms | N-(7-Methoxy-5,8-Dioxo-6-Quinolyl)Acetamide; N-(5,8-Diketo-7-Methoxy-6-Quinolyl)Acetamide; N-(7-Methoxy-5,8-Dioxo-Quinolin-6-Yl)Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 |
| CAS Registry Number | 93404-61-6 |
| SMILES | C1=CC=NC2=C1C(=O)C(=C(C2=O)OC)NC(=O)C |
| InChI | 1S/C12H10N2O4/c1-6(15)14-9-10(16)7-4-3-5-13-8(7)11(17)12(9)18-2/h3-5H,1-2H3,(H,14,15) |
| InChIKey | YLXDEMBWRKQZBI-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.767°C at 760 mmHg (Cal.) |
| Flash point | 259.679°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Acetamido-7-Methoxy-5,8-Quinolinedione |