|
CAS#: 93408-11-8 Product: N-(Carbazol-9-Ylmethyl)-2-Chloro-N-(2-Chloroethyl)Ethanamine No suppilers available for the product. |
| Name | N-(Carbazol-9-Ylmethyl)-2-Chloro-N-(2-Chloroethyl)Ethanamine |
|---|---|
| Synonyms | N-(9-Carbazolylmethyl)-2-Chloro-N-(2-Chloroethyl)Ethanamine; Carbazol-9-Ylmethyl-Bis(2-Chloroethyl)Amine; Nciopen2_008082 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 |
| CAS Registry Number | 93408-11-8 |
| SMILES | C1=CC=CC2=C1[N](CN(CCCl)CCCl)C3=C2C=CC=C3 |
| InChI | 1S/C17H18Cl2N2/c18-9-11-20(12-10-19)13-21-16-7-3-1-5-14(16)15-6-2-4-8-17(15)21/h1-8H,9-13H2 |
| InChIKey | HNFNFZFQNLYOQS-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.344°C at 760 mmHg (Cal.) |
| Flash point | 204.388°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Carbazol-9-Ylmethyl)-2-Chloro-N-(2-Chloroethyl)Ethanamine |