|
CAS#: 93553-55-0 Product: 3-(3,5-Dichlorophenyl)-1-Methyl-2,5-Pyrrolidinedione No suppilers available for the product. |
| Name | 3-(3,5-Dichlorophenyl)-1-Methyl-2,5-Pyrrolidinedione |
|---|---|
| Synonyms | 3-(3,5-Dichlorophenyl)-1-Methyl-Pyrrolidine-2,5-Dione; 3-(3,5-Dichlorophenyl)-1-Methyl-Pyrrolidine-2,5-Quinone; 2,5-Pyrrolidinedione, 3-(3,5-Dichlorophenyl)-1-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.10 |
| CAS Registry Number | 93553-55-0 |
| SMILES | C1=C(C=C(C=C1C2C(=O)N(C(C2)=O)C)Cl)Cl |
| InChI | 1S/C11H9Cl2NO2/c1-14-10(15)5-9(11(14)16)6-2-7(12)4-8(13)3-6/h2-4,9H,5H2,1H3 |
| InChIKey | JFMFCONNXYHWLV-UHFFFAOYSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.313°C at 760 mmHg (Cal.) |
| Flash point | 197.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,5-Dichlorophenyl)-1-Methyl-2,5-Pyrrolidinedione |