|
CAS#: 93777-42-5 Product: 2-(4,7,7-Trimethylbicyclo[4.1.0]hept-4-en-3-yl)-2-propanol No suppilers available for the product. |
| Name | 2-(4,7,7-Trimethylbicyclo[4.1.0]hept-4-en-3-yl)-2-propanol |
|---|---|
| Synonyms | α,α,4,7,7-pentamethylbicyclo[4.1.0]hept-4-ene-3-methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.31 |
| CAS Registry Number | 93777-42-5 |
| EINECS | 298-073-9 |
| SMILES | CC2(C)C1C=C(C)C(CC12)C(C)(C)O |
| InChI | 1S/C13H22O/c1-8-6-10-11(12(10,2)3)7-9(8)13(4,5)14/h6,9-11,14H,7H2,1-5H3 |
| InChIKey | KRUIQQGWBAELRN-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.43°C at 760 mmHg (Cal.) |
| Flash point | 95.056°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4,7,7-Trimethylbicyclo[4.1.0]hept-4-en-3-yl)-2-propanol |