Online Database of Chemicals from Around the World
|
CAS#: 93777-67-4 Product: N-[2-(Diethylamino)ethyl]-2-phenyl-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1) No suppilers available for the product. |
| Name | N-[2-(Diethylamino)ethyl]-2-phenyl-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1) |
|---|---|
| Synonyms | N-[2-(die |
| Molecular Structure | ![CAS#: 93777-67-4, N-[2-(Diethylamino)ethyl]-2-phenyl-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1)](/moreStructures/93777-67-4.gif) |
| Molecular Formula | C24H33ClN2O4 |
| Molecular Weight | 448.98 |
| CAS Registry Number | 93777-67-4 |
| EINECS | 298-100-4 |
| SMILES | Cl.COc1cc(OC)c(cc1OC)C=C(c2ccccc2)C(=O)NCCN(CC)CC |
| InChI | 1S/C24H32N2O4.ClH/c1-6-26(7-2)14-13-25-24(27)20(18-11-9-8-10-12-18)15-19-16-22(29-4)23(30-5)17-21(19)28-3;/h8-12,15-17H,6-7,13-14H2,1-5H3,(H,25,27);1H |
| InChIKey | WGYHILCUZAUZAB-UHFFFAOYSA-N |
| Boiling point | 614.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 325.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(Diethylamino)ethyl]-2-phenyl-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1) |