|
CAS#: 93777-62-9 Product: N-[2-(Diethylamino)ethyl]-2-(4-nitrophenyl)-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1) No suppilers available for the product. |
| Name | N-[2-(Diethylamino)ethyl]-2-(4-nitrophenyl)-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1) |
|---|---|
| Synonyms | N-[2-(die |
| Molecular Structure | ![]() |
| Molecular Formula | C24H32ClN3O6 |
| Molecular Weight | 493.98 |
| CAS Registry Number | 93777-62-9 |
| EINECS | 298-094-3 |
| SMILES | Cl.COc1cc(OC)c(cc1OC)C=C(c2ccc(cc2)[N+]([O-])=O)C(=O)NCCN(CC)CC |
| InChI | 1S/C24H31N3O6.ClH/c1-6-26(7-2)13-12-25-24(28)20(17-8-10-19(11-9-17)27(29)30)14-18-15-22(32-4)23(33-5)16-21(18)31-3;/h8-11,14-16H,6-7,12-13H2,1-5H3,(H,25,28);1H |
| InChIKey | XUPBHZSNESEJTQ-UHFFFAOYSA-N |
| Boiling point | 650.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 347.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(Diethylamino)ethyl]-2-(4-nitrophenyl)-3-(2,4,5-trimethoxyphenyl)acrylamide hydrochloride (1:1) |