|
CAS#: 93778-16-6 Product: Bis[2-(3,4-dihydroxyphenyl)-N-methyl-2-oxoethanaminium] sulfate No suppilers available for the product. |
| Name | Bis[2-(3,4-dihydroxyphenyl)-N-methyl-2-oxoethanaminium] sulfate |
|---|---|
| Synonyms | bis[[2-(3 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N2O10S |
| Molecular Weight | 460.46 |
| CAS Registry Number | 93778-16-6 |
| EINECS | 298-150-7 |
| SMILES | Oc1ccc(cc1O)C(=O)C[NH2+]C.[O-]S([O-])(=O)=O.C[NH2+]CC(=O)c1cc(O)c(O)cc1 |
| InChI | 1S/2C9H11NO3.H2O4S/c2*1-10-5-9(13)6-2-3-7(11)8(12)4-6;1-5(2,3)4/h2*2-4,10-12H,5H2,1H3;(H2,1,2,3,4) |
| InChIKey | RDJANFDMGBFNOM-UHFFFAOYSA-N |
| Boiling point | 809°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 443.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[2-(3,4-dihydroxyphenyl)-N-methyl-2-oxoethanaminium] sulfate |