|
CAS#: 93840-77-8 Product: 4-(2,5-Dimethylcyclohexylidene)-2-Butenal No suppilers available for the product. |
| Name | 4-(2,5-Dimethylcyclohexylidene)-2-Butenal |
|---|---|
| Synonyms | 4-(2,5-Dimethylcyclohexylidene)-2-Butenal |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 93840-77-8 |
| EINECS | 298-943-8 |
| SMILES | CC1C(=C/C=C/C=O)/CC(CC1)C |
| InChI | 1S/C12H18O/c1-10-6-7-11(2)12(9-10)5-3-4-8-13/h3-5,8,10-11H,6-7,9H2,1-2H3/b4-3+,12-5+ |
| InChIKey | GJCPNEBGQGWASY-ZDHPXMGNSA-N |
| Density | 0.95g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.742°C at 760 mmHg (Cal.) |
| Flash point | 137.046°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,5-Dimethylcyclohexylidene)-2-Butenal |