|
CAS#: 93842-86-5 Product: Diethylmethyl[1-Methyl-1-[(2-Methyl-1-Oxoallyl)Oxy]Ethyl]Ammonium Methyl Sulphate No suppilers available for the product. |
| Name | Diethylmethyl[1-Methyl-1-[(2-Methyl-1-Oxoallyl)Oxy]Ethyl]Ammonium Methyl Sulphate |
|---|---|
| Synonyms | 1-Ethylpropyl-[1-Methyl-1-(2-Methylprop-2-Enoyloxy)Ethyl]Ammonium; Methyl Sulfate; 1-Ethylpropyl-[1-Methyl-1-(2-Methyl-1-Oxoprop-2-Enoxy)Ethyl]Ammonium; Methyl Sulfate; 1-Ethylpropyl-(1-Methacryloyloxy-1-Methyl-Ethyl)Ammonium; Methyl Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H27NO6S |
| Molecular Weight | 325.42 |
| CAS Registry Number | 93842-86-5 |
| EINECS | 299-065-8 |
| SMILES | CO[S](=O)(=O)[O-].C(C([NH2+]C(OC(=O)C(=C)C)(C)C)CC)C |
| InChI | 1S/C12H23NO2.CH4O4S/c1-7-10(8-2)13-12(5,6)15-11(14)9(3)4;1-5-6(2,3)4/h10,13H,3,7-8H2,1-2,4-6H3;1H3,(H,2,3,4) |
| InChIKey | ROCNIIWFKNMTHF-UHFFFAOYSA-N |
| Boiling point | 262°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 112.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylmethyl[1-Methyl-1-[(2-Methyl-1-Oxoallyl)Oxy]Ethyl]Ammonium Methyl Sulphate |