|
CAS#: 93842-95-6 Product: Diethylmethyl[1-Methyl-1-[(1-Oxoallyl)Oxy]Ethyl]Ammonium Sulphate No suppilers available for the product. |
| Name | Diethylmethyl[1-Methyl-1-[(1-Oxoallyl)Oxy]Ethyl]Ammonium Sulphate |
|---|---|
| Synonyms | 1-Ethylpropyl-(1-Methyl-1-Prop-2-Enoyloxy-Ethyl)Ammonium Sulfate; 1-Ethylpropyl-[1-Methyl-1-(1-Oxoprop-2-Enoxy)Ethyl]Ammonium Sulfate; (1-Acryloyloxy-1-Methyl-Ethyl)-(1-Ethylpropyl)Ammonium Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22NO6S |
| Molecular Weight | 296.36 |
| CAS Registry Number | 93842-95-6 |
| EINECS | 299-072-6 |
| SMILES | O=[S]([O-])([O-])=O.C(C([NH2+]C(OC(=O)C=C)(C)C)CC)C |
| InChI | 1S/C11H21NO2.H2O4S/c1-6-9(7-2)12-11(4,5)14-10(13)8-3;1-5(2,3)4/h8-9,12H,3,6-7H2,1-2,4-5H3;(H2,1,2,3,4)/p-1 |
| InChIKey | OZZGGRFNPRTATA-UHFFFAOYSA-M |
| Boiling point | 243.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylmethyl[1-Methyl-1-[(1-Oxoallyl)Oxy]Ethyl]Ammonium Sulphate |