|
CAS#: 93849-31-1 Product: Ethyl 5-fluoro-1-benzofuran-2-carboxylate No suppilers available for the product. |
| Name | Ethyl 5-fluoro-1-benzofuran-2-carboxylate |
|---|---|
| Synonyms | 2-Benzofurancarboxylic acid, 5-fluoro-, ethyl ester; Ethyl 5-fluoro-1-benzofuran-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9FO3 |
| Molecular Weight | 208.19 |
| CAS Registry Number | 93849-31-1 |
| SMILES | Fc2cc1c(oc(c1)C(=O)OCC)cc2 |
| InChI | 1S/C11H9FO3/c1-2-14-11(13)10-6-7-5-8(12)3-4-9(7)15-10/h3-6H,2H2,1H3 |
| InChIKey | RBQUPHUYCPBKSF-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.948°C at 760 mmHg (Cal.) |
| Flash point | 121.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-fluoro-1-benzofuran-2-carboxylate |