|
CAS#: 93856-99-6 Product: 2-(7-Methoxy-10-methyl-10H-phenothiazin-2-yl)propanal No suppilers available for the product. |
| Name | 2-(7-Methoxy-10-methyl-10H-phenothiazin-2-yl)propanal |
|---|---|
| Synonyms | 7-methoxy-α,10-dimethyl-10H-phenothiazine-2-acetaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 |
| CAS Registry Number | 93856-99-6 |
| EINECS | 299-134-2 |
| SMILES | O=CC(C)c1ccc2Sc3cc(OC)ccc3N(C)c2c1 |
| InChI | 1S/C17H17NO2S/c1-11(10-19)12-4-7-16-15(8-12)18(2)14-6-5-13(20-3)9-17(14)21-16/h4-11H,1-3H3 |
| InChIKey | XKENBZAHEKKCMD-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.19°C at 760 mmHg (Cal.) |
| Flash point | 245.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(7-Methoxy-10-methyl-10H-phenothiazin-2-yl)propanal |