|
CAS#: 93892-05-8 Product: (1S,2S,5S)-5-Isopropenyl-2-methylcyclohexyl 3-methylbutanoate No suppilers available for the product. |
| Name | (1S,2S,5S)-5-Isopropenyl-2-methylcyclohexyl 3-methylbutanoate |
|---|---|
| Synonyms | (1α,2β,5α)-5-isopropenyl-2-methylcyclohexyl isovalerate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 93892-05-8 |
| EINECS | 299-485-1 |
| SMILES | O=C(O[C@H]1C[C@H](CC[C@@H]1C)C(C)=C)CC(C)C |
| InChI | 1S/C15H26O2/c1-10(2)8-15(16)17-14-9-13(11(3)4)7-6-12(14)5/h10,12-14H,3,6-9H2,1-2,4-5H3/t12-,13-,14-/m0/s1 |
| InChIKey | HCPAIAFKHZTLIH-IHRRRGAJSA-N |
| Density | 0.923g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.137°C at 760 mmHg (Cal.) |
| Flash point | 122.871°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2S,5S)-5-Isopropenyl-2-methylcyclohexyl 3-methylbutanoate |