|
CAS#: 93892-31-0 Product: 6-tert-Butyl-2-Cyclopentylphenol No suppilers available for the product. |
| Name | 6-tert-Butyl-2-Cyclopentylphenol |
|---|---|
| Synonyms | 2-Tert-Butyl-6-Cyclopentyl-Phenol; 6-Tert-Butyl-2-Cyclopentylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 93892-31-0 |
| EINECS | 299-513-2 |
| SMILES | C2=C(C(C)(C)C)C(=C(C1CCCC1)C=C2)O |
| InChI | 1S/C15H22O/c1-15(2,3)13-10-6-9-12(14(13)16)11-7-4-5-8-11/h6,9-11,16H,4-5,7-8H2,1-3H3 |
| InChIKey | ABLULJUGVQLKDY-UHFFFAOYSA-N |
| Density | 1.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.493°C at 760 mmHg (Cal.) |
| Flash point | 117.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-tert-Butyl-2-Cyclopentylphenol |