|
CAS#: 93893-66-4 Product: Methyl N-(2-cyanoethyl)-N-phenyl-beta-alaninate acetate (1:1) No suppilers available for the product. |
| Name | Methyl N-(2-cyanoethyl)-N-phenyl-beta-alaninate acetate (1:1) |
|---|---|
| Synonyms | N-(2-cyanoethyl)-O-methyl-N-phenyl-β-alanine monoacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 |
| CAS Registry Number | 93893-66-4 |
| EINECS | 299-657-6 |
| SMILES | CC(O)=O.COC(=O)CCN(CCC#N)c1ccccc1 |
| InChI | 1S/C13H16N2O2.C2H4O2/c1-17-13(16)8-11-15(10-5-9-14)12-6-3-2-4-7-12;1-2(3)4/h2-4,6-7H,5,8,10-11H2,1H3;1H3,(H,3,4) |
| InChIKey | GFRRNHZVFCFETR-UHFFFAOYSA-N |
| Boiling point | 504.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 258.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-(2-cyanoethyl)-N-phenyl-beta-alaninate acetate (1:1) |