|
CAS#: 93894-21-4 Product: 2-Ethyl-1-Methylhex-1-Enyl Acetate No suppilers available for the product. |
| Name | 2-Ethyl-1-Methylhex-1-Enyl Acetate |
|---|---|
| Synonyms | [(E)-2-Ethyl-1-Methyl-Hex-1-Enyl] Acetate; Acetic Acid [(E)-2-Ethyl-1-Methylhex-1-Enyl] Ester; Acetic Acid [(E)-2-Ethyl-1-Methyl-Hex-1-Enyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 93894-21-4 |
| EINECS | 299-717-1 |
| SMILES | C(CCC)\C(CC)=C(OC(=O)C)/C |
| InChI | 1S/C11H20O2/c1-5-7-8-11(6-2)9(3)13-10(4)12/h5-8H2,1-4H3/b11-9+ |
| InChIKey | RTJHPUJQCPDVGT-PKNBQFBNSA-N |
| Density | 0.891g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.017°C at 760 mmHg (Cal.) |
| Flash point | 79.089°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-1-Methylhex-1-Enyl Acetate |