Online Database of Chemicals from Around the World
|
CAS#: 93894-53-2 Product: 1,1,2,2,3,3,4,4-Octafluoro-N-(2-Hydroxyethyl)-N-Methylbutane-1-Sulphonamide No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4-Octafluoro-N-(2-Hydroxyethyl)-N-Methylbutane-1-Sulphonamide |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4-Octafluoro-N-(2-Hydroxyethyl)-N-Methyl-Butane-1-Sulfonamide; 1,1,2,2,3,3,4,4-Octafluoro-N-(2-Hydroxyethyl)-N-Methylbutane-1-Sulphonamide |
| Molecular Structure |  |
| Molecular Formula | C7H9F8NO3S |
| Molecular Weight | 339.20 |
| CAS Registry Number | 93894-53-2 |
| EINECS | 299-752-2 |
| SMILES | C(O)CN([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F)C |
| InChI | 1S/C7H9F8NO3S/c1-16(2-3-17)20(18,19)7(14,15)6(12,13)5(10,11)4(8)9/h4,17H,2-3H2,1H3 |
| InChIKey | HVRZEMISTDPHLI-UHFFFAOYSA-N |
| Density | 1.585g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.741°C at 760 mmHg (Cal.) |
| Flash point | 119.96°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4-Octafluoro-N-(2-Hydroxyethyl)-N-Methylbutane-1-Sulphonamide |