Online Database of Chemicals from Around the World
|
CAS#: 93894-54-3 Product: 1,1,2,2,3,3,4,4-Octafluoro-N,N-Bis(2-Hydroxyethyl)Butane-1-Sulphonamide No suppilers available for the product. |
| Name | 1,1,2,2,3,3,4,4-Octafluoro-N,N-Bis(2-Hydroxyethyl)Butane-1-Sulphonamide |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4-Octafluoro-N,N-Bis(2-Hydroxyethyl)Butane-1-Sulphonamide |
| Molecular Structure |  |
| Molecular Formula | C8H11F8NO4S |
| Molecular Weight | 369.23 |
| CAS Registry Number | 93894-54-3 |
| EINECS | 299-753-8 |
| SMILES | C(O)CN([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F)CCO |
| InChI | 1S/C8H11F8NO4S/c9-5(10)6(11,12)7(13,14)8(15,16)22(20,21)17(1-3-18)2-4-19/h5,18-19H,1-4H2 |
| InChIKey | QUQDQNCPLSSGOU-UHFFFAOYSA-N |
| Density | 1.62g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.674°C at 760 mmHg (Cal.) |
| Flash point | 164.672°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4-Octafluoro-N,N-Bis(2-Hydroxyethyl)Butane-1-Sulphonamide |