Online Database of Chemicals from Around the World
|
CAS#: 93904-64-4 Product: 3-Chloro-4-Hydroxy-5-(Isopropyl)Benzaldehyde No suppilers available for the product. |
| Name | 3-Chloro-4-Hydroxy-5-(Isopropyl)Benzaldehyde |
|---|---|
| Synonyms | 3-Chloro-4-Hydroxy-5-Isopropyl-Benzaldehyde; 3-Chloro-4-Hydroxy-5-Isopropylbenzaldehyde; 3-Chloro-4-Hydroxy-5-Propan-2-Yl-Benzaldehyde |
| Molecular Structure |  |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 |
| CAS Registry Number | 93904-64-4 |
| EINECS | 299-803-9 |
| SMILES | C1=C(C=O)C=C(C(C)C)C(=C1Cl)O |
| InChI | 1S/C10H11ClO2/c1-6(2)8-3-7(5-12)4-9(11)10(8)13/h3-6,13H,1-2H3 |
| InChIKey | MJPDRZNCPYMJSA-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.93°C at 760 mmHg (Cal.) |
| Flash point | 117.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-Hydroxy-5-(Isopropyl)Benzaldehyde |