|
CAS#: 93921-83-6 Product: 3-C-Methylerythritol No suppilers available for the product. |
| Name | 3-C-Methylerythritol |
|---|---|
| Synonyms | 2-C-Methylerythritol; 2-Methylerythritol; 3-C-Methylerythritol |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 |
| CAS Registry Number | 93921-83-6 |
| SMILES | [C@]([C@@H](O)CO)(O)(CO)C |
| InChI | 1S/C5H12O4/c1-5(9,3-7)4(8)2-6/h4,6-9H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | HGVJFBSSLICXEM-CRCLSJGQSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.127°C at 760 mmHg (Cal.) |
| Flash point | 193.036°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-C-Methylerythritol |