|
CAS#: 93940-33-1 Product: N-(2,4-Dichlorophenyl)-3-(1-piperidinyl)butanamide hydrochloride (1:1) No suppilers available for the product. |
| Name | N-(2,4-Dichlorophenyl)-3-(1-piperidinyl)butanamide hydrochloride (1:1) |
|---|---|
| Synonyms | N-(2,4-di |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21Cl3N2O |
| Molecular Weight | 351.70 |
| CAS Registry Number | 93940-33-1 |
| EINECS | 300-428-0 |
| SMILES | Cl.CC(CC(=O)Nc1ccc(Cl)cc1Cl)N2CCCCC2 |
| InChI | 1S/C15H20Cl2N2O.ClH/c1-11(19-7-3-2-4-8-19)9-15(20)18-14-6-5-12(16)10-13(14)17;/h5-6,10-11H,2-4,7-9H2,1H3,(H,18,20);1H |
| InChIKey | ABPFCLBHEOJRTQ-UHFFFAOYSA-N |
| Boiling point | 491.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 251.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4-Dichlorophenyl)-3-(1-piperidinyl)butanamide hydrochloride (1:1) |