|
CAS#: 93941-01-6 Product: 1-(1-Oxobutyl)-1H-Indole No suppilers available for the product. |
| Name | 1-(1-Oxobutyl)-1H-Indole |
|---|---|
| Synonyms | 1-(1-Indolyl)Butan-1-One; 1-(1-Oxobutyl)-1H-Indole; Nsc84178 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| CAS Registry Number | 93941-01-6 |
| EINECS | 300-500-1 |
| SMILES | C1=CC=CC2=C1[N](C(CCC)=O)C=C2 |
| InChI | 1S/C12H13NO/c1-2-5-12(14)13-9-8-10-6-3-4-7-11(10)13/h3-4,6-9H,2,5H2,1H3 |
| InChIKey | AJZZYHUKCOKFPJ-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.15°C at 760 mmHg (Cal.) |
| Flash point | 130.488°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Oxobutyl)-1H-Indole |