|
CAS#: 93942-48-4 Product: 1-[5-Isopropyl-2-Methylphenyl]-2-Buten-1-One No suppilers available for the product. |
| Name | 1-[5-Isopropyl-2-Methylphenyl]-2-Buten-1-One |
|---|---|
| Synonyms | (E)-1-(5-Isopropyl-2-Methyl-Phenyl)But-2-En-1-One; (E)-1-(5-Isopropyl-2-Methylphenyl)But-2-En-1-One; (E)-1-(2-Methyl-5-Propan-2-Yl-Phenyl)But-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 |
| CAS Registry Number | 93942-48-4 |
| EINECS | 300-601-0 |
| SMILES | C1=C(C(C)C)C=CC(=C1C(=O)\C=C\C)C |
| InChI | 1S/C14H18O/c1-5-6-14(15)13-9-12(10(2)3)8-7-11(13)4/h5-10H,1-4H3/b6-5+ |
| InChIKey | LKGGURDBIFFQGN-AATRIKPKSA-N |
| Density | 0.946g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.046°C at 760 mmHg (Cal.) |
| Flash point | 127.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[5-Isopropyl-2-Methylphenyl]-2-Buten-1-One |