|
CAS#: 93942-55-3 Product: 2,2-Diphenyl-4-(1-piperidinyl)pentanenitrile hydrochloride (1:1) No suppilers available for the product. |
| Name | 2,2-Diphenyl-4-(1-piperidinyl)pentanenitrile hydrochloride (1:1) |
|---|---|
| Synonyms | γ-methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H27ClN2 |
| Molecular Weight | 354.92 |
| CAS Registry Number | 93942-55-3 |
| EINECS | 300-608-9 |
| SMILES | Cl.N#CC(CC(C)N1CCCCC1)(c2ccccc2)c3ccccc3 |
| InChI | 1S/C22H26N2.ClH/c1-19(24-15-9-4-10-16-24)17-22(18-23,20-11-5-2-6-12-20)21-13-7-3-8-14-21;/h2-3,5-8,11-14,19H,4,9-10,15-17H2,1H3;1H |
| InChIKey | LWRAGUAXVRBIRB-UHFFFAOYSA-N |
| Boiling point | 500.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 256.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Diphenyl-4-(1-piperidinyl)pentanenitrile hydrochloride (1:1) |