Online Database of Chemicals from Around the World
|
CAS#: 93962-67-5 Product: 1-(4-Chlorophenyl)-3-(5-Chloro-2-Hydroxyphenyl)Propan-1-Ol No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-3-(5-Chloro-2-Hydroxyphenyl)Propan-1-Ol |
|---|---|
| Synonyms | 4-Chloro-2-[3-(4-Chlorophenyl)-3-Hydroxy-Propyl]Phenol; 1-(P-Chlorophenyl)-3-(5-Chloro-2-Hydroxyphenyl)Propan-1-Ol |
| Molecular Structure |  |
| Molecular Formula | C15H14Cl2O2 |
| Molecular Weight | 297.18 |
| CAS Registry Number | 93962-67-5 |
| EINECS | 300-705-6 |
| SMILES | C1=C(Cl)C=CC(=C1CCC(O)C2=CC=C(Cl)C=C2)O |
| InChI | 1S/C15H14Cl2O2/c16-12-4-1-10(2-5-12)14(18)7-3-11-9-13(17)6-8-15(11)19/h1-2,4-6,8-9,14,18-19H,3,7H2 |
| InChIKey | ZRSNFMIYYITIIK-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.926°C at 760 mmHg (Cal.) |
| Flash point | 226.512°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-3-(5-Chloro-2-Hydroxyphenyl)Propan-1-Ol |