|
CAS#: 93963-14-5 Product: 1-(2-Ethyl-4,4-Dimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One No suppilers available for the product. |
| Name | 1-(2-Ethyl-4,4-Dimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One |
|---|---|
| Synonyms | 1-(2-Ethyl-4,4-Dimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 93963-14-5 |
| EINECS | 300-754-3 |
| SMILES | C(C1=CC(CCC1C(=O)\C=C\C)(C)C)C |
| InChI | 1S/C14H22O/c1-5-7-13(15)12-8-9-14(3,4)10-11(12)6-2/h5,7,10,12H,6,8-9H2,1-4H3/b7-5+ |
| InChIKey | YAGSMBWTDVIGQC-FNORWQNLSA-N |
| Density | 0.891g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.297°C at 760 mmHg (Cal.) |
| Flash point | 114.733°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Ethyl-4,4-Dimethyl-2-Cyclohexen-1-Yl)-2-Buten-1-One |