|
CAS#: 94021-77-9 Product: 2-(3-Fluoro-4-biphenylyl)propanamide No suppilers available for the product. |
| Name | 2-(3-Fluoro-4-biphenylyl)propanamide |
|---|---|
| Synonyms | 3-fluoro-α-methyl[1,1'-biphenyl]-4-acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 |
| CAS Registry Number | 94021-77-9 |
| EINECS | 301-468-1 |
| SMILES | CC(c1ccc(cc1F)c2ccccc2)C(N)=O |
| InChI | 1S/C15H14FNO/c1-10(15(17)18)13-8-7-12(9-14(13)16)11-5-3-2-4-6-11/h2-10H,1H3,(H2,17,18) |
| InChIKey | XWWZKEFHSMFCCA-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.05°C at 760 mmHg (Cal.) |
| Flash point | 207.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Fluoro-4-biphenylyl)propanamide |