|
CAS#: 94022-01-2 Product: Trans-3,4,4a,5,8,8a-Hexahydro-3,3,6,7-Tetramethyl-1H-2-Benzopyran No suppilers available for the product. |
| Name | Trans-3,4,4a,5,8,8a-Hexahydro-3,3,6,7-Tetramethyl-1H-2-Benzopyran |
|---|---|
| Synonyms | Cis-3,4,4A,5,8,8A-Hexahydro-3,3,6,7-Tetramethyl-1H-2-Benzopyran; Trans-3,4,4A,5,8,8A-Hexahydro-3,3,6,7-Tetramethyl-1H-2-Benzopyran |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 94022-01-2 (94022-02-3) |
| EINECS | 301-493-8 |
| SMILES | CC1(OCC2C(C1)CC(=C(C2)C)C)C |
| InChI | 1S/C13H22O/c1-9-5-11-7-13(3,4)14-8-12(11)6-10(9)2/h11-12H,5-8H2,1-4H3 |
| InChIKey | RZLXGTKIGFFSMN-UHFFFAOYSA-N |
| Density | 0.895g/cm3 (Cal.) |
|---|---|
| Boiling point | 252°C at 760 mmHg (Cal.) |
| Flash point | 102.495°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trans-3,4,4a,5,8,8a-Hexahydro-3,3,6,7-Tetramethyl-1H-2-Benzopyran |