Online Database of Chemicals from Around the World
|
CAS#: 94022-18-1 Product: 5-tert-Butyl-2-Cyclopentyl-m-Cresol No suppilers available for the product. |
| Name | 5-tert-Butyl-2-Cyclopentyl-m-Cresol |
|---|---|
| Synonyms | 5-Tert-Butyl-2-Cyclopentyl-3-Methyl-Phenol; 5-Tert-Butyl-2-Cyclopentyl-M-Cresol |
| Molecular Structure |  |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 |
| CAS Registry Number | 94022-18-1 |
| EINECS | 301-513-5 |
| SMILES | C1=C(C(C)(C)C)C=C(C(=C1O)C2CCCC2)C |
| InChI | 1S/C16H24O/c1-11-9-13(16(2,3)4)10-14(17)15(11)12-7-5-6-8-12/h9-10,12,17H,5-8H2,1-4H3 |
| InChIKey | SERZLZFBVGSYLP-UHFFFAOYSA-N |
| Density | 0.992g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.708°C at 760 mmHg (Cal.) |
| Flash point | 137.14°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-tert-Butyl-2-Cyclopentyl-m-Cresol |