|
CAS#: 94088-61-6 Product: 1-Benzyl-3-{[4-(diethylamino)phenyl]diazenyl}-4-methyl-5-phenyl-4,5-dihydro-1H-1,2,4-triazol-1-ium methyl sulfate No suppilers available for the product. |
| Name | 1-Benzyl-3-{[4-(diethylamino)phenyl]diazenyl}-4-methyl-5-phenyl-4,5-dihydro-1H-1,2,4-triazol-1-ium methyl sulfate |
|---|---|
| Synonyms | 1-benzyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H34N6O4S |
| Molecular Weight | 538.66 |
| CAS Registry Number | 94088-61-6 |
| EINECS | 302-062-7 |
| SMILES | [O-]S(=O)(=O)OC.CCN(CC)c1ccc(cc1)N=N\C3=N\[NH+](Cc2ccccc2)C(N3C)c4ccccc4 |
| InChI | 1S/C26H30N6.CH4O4S/c1-4-31(5-2)24-18-16-23(17-19-24)27-28-26-29-32(20-21-12-8-6-9-13-21)25(30(26)3)22-14-10-7-11-15-22;1-5-6(2,3)4/h6-19,25H,4-5,20H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | TXBYCIQJWGLANG-UHFFFAOYSA-N |
| Boiling point | 690.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 371.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-3-{[4-(diethylamino)phenyl]diazenyl}-4-methyl-5-phenyl-4,5-dihydro-1H-1,2,4-triazol-1-ium methyl sulfate |