|
CAS#: 94107-73-0 Product: P,P'-[[(2-ethylhexyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) No suppilers available for the product. |
| Name | P,P'-[[(2-ethylhexyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) |
|---|---|
| Synonyms | diammoniu |
| Molecular Structure | ![]() |
| Molecular Formula | C10H29N3O6P2 |
| Molecular Weight | 349.30 |
| CAS Registry Number | 94107-73-0 |
| EINECS | 302-308-3 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)CN(CP(=O)([O-])[O-])CC(CC)CCCC |
| InChI | 1S/C10H25NO6P2.2H3N/c1-3-5-6-10(4-2)7-11(8-18(12,13)14)9-19(15,16)17;;/h10H,3-9H2,1-2H3,(H2,12,13,14)(H2,15,16,17);2*1H3/p-2 |
| InChIKey | QHRUBDXIOFVCOS-UHFFFAOYSA-L |
| Boiling point | 604.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 319.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for P,P'-[[(2-ethylhexyl)imino]bis(methylene)]bis-Phosphonate ammonium salt (1:2) |