|
CAS#: 94108-00-6 Product: Sodium Nonyl Phthalate No suppilers available for the product. |
| Name | Sodium Nonyl Phthalate |
|---|---|
| Synonyms | Sodium 2-(Nonoxy-Oxomethyl)Benzoate; Sodium Nonyl Phthalate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NaO4 |
| Molecular Weight | 314.36 |
| CAS Registry Number | 94108-00-6 |
| EINECS | 302-337-1 |
| SMILES | C1=CC=CC(=C1C(OCCCCCCCCC)=O)C([O-])=O.[Na+] |
| InChI | 1S/C17H24O4.Na/c1-2-3-4-5-6-7-10-13-21-17(20)15-12-9-8-11-14(15)16(18)19;/h8-9,11-12H,2-7,10,13H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | JHDVLLBHVWBRDZ-UHFFFAOYSA-M |
| Boiling point | 427.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 148.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Nonyl Phthalate |