|
CAS#: 94108-50-6 Product: Lithium 7-Methyloctanoate No suppilers available for the product. |
| Name | Lithium 7-Methyloctanoate |
|---|---|
| Synonyms | Lithium 7-Methylcaprylate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H17LiO2 |
| Molecular Weight | 164.17 |
| CAS Registry Number | 94108-50-6 |
| EINECS | 302-391-6 |
| SMILES | C(C([O-])=O)CCCCC(C)C.[Li+] |
| InChI | 1S/C9H18O2.Li/c1-8(2)6-4-3-5-7-9(10)11;/h8H,3-7H2,1-2H3,(H,10,11);/q;+1/p-1 |
| InChIKey | CTAKQHPOILPIRW-UHFFFAOYSA-M |
| Boiling point | 253.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 129.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium 7-Methyloctanoate |