|
CAS#: 94109-62-3 Product: Bis{N-benzyl-N-[2-(3,5-dihydroxyphenyl)-2-oxoethyl]-2-methyl-2-propanaminium} sulfate No suppilers available for the product. |
| Name | Bis{N-benzyl-N-[2-(3,5-dihydroxyphenyl)-2-oxoethyl]-2-methyl-2-propanaminium} sulfate |
|---|---|
| Synonyms | bis[benzy |
| Molecular Structure | ![]() |
| Molecular Formula | C38H48N2O10S |
| Molecular Weight | 724.86 |
| CAS Registry Number | 94109-62-3 |
| EINECS | 302-502-8 |
| SMILES | Oc1cc(cc(O)c1)C(=O)C[NH+](Cc2ccccc2)C(C)(C)C.[O-]S([O-])(=O)=O.CC(C)(C)[NH+](Cc1ccccc1)CC(=O)c2cc(O)cc(O)c2 |
| InChI | 1S/2C19H23NO3.H2O4S/c2*1-19(2,3)20(12-14-7-5-4-6-8-14)13-18(23)15-9-16(21)11-17(22)10-15;1-5(2,3)4/h2*4-11,21-22H,12-13H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | ONKMOYRCSWGGBN-UHFFFAOYSA-N |
| Boiling point | 875.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 483.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis{N-benzyl-N-[2-(3,5-dihydroxyphenyl)-2-oxoethyl]-2-methyl-2-propanaminium} sulfate |