|
CAS#: 94133-50-3 Product: Diethylammonium Octyl Sulphate No suppilers available for the product. |
| Name | Diethylammonium Octyl Sulphate |
|---|---|
| Synonyms | Diethylammonium; Octyl Sulfate; Diethylammonium Octyl Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H29NO4S |
| Molecular Weight | 283.43 |
| CAS Registry Number | 94133-50-3 |
| EINECS | 302-710-9 |
| SMILES | C(O[S]([O-])(=O)=O)CCCCCCC.C([NH2+]CC)C |
| InChI | 1S/C8H18O4S.C4H11N/c1-2-3-4-5-6-7-8-12-13(9,10)11;1-3-5-4-2/h2-8H2,1H3,(H,9,10,11);5H,3-4H2,1-2H3 |
| InChIKey | QKUYHGMVYZSEGO-UHFFFAOYSA-N |
| Boiling point | 387.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 188.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethylammonium Octyl Sulphate |