|
CAS#: 94133-66-1 Product: 1,3-Dichloro-9-Methyl-6-(Trifluoromethyl)Phenanthrene No suppilers available for the product. |
| Name | 1,3-Dichloro-9-Methyl-6-(Trifluoromethyl)Phenanthrene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H9Cl2F3 |
| Molecular Weight | 329.15 |
| CAS Registry Number | 94133-66-1 |
| EINECS | 302-728-7 |
| SMILES | C2=C(Cl)C1=CC(=C3C(=C1C=C2Cl)C=C(C(F)(F)F)C=C3)C |
| InChI | 1S/C16H9Cl2F3/c1-8-4-14-13(6-10(17)7-15(14)18)12-5-9(16(19,20)21)2-3-11(8)12/h2-7H,1H3 |
| InChIKey | BDHXSUNSZPJEMF-UHFFFAOYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.464°C at 760 mmHg (Cal.) |
| Flash point | 234.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-9-Methyl-6-(Trifluoromethyl)Phenanthrene |