|
CAS#: 94133-80-9 Product: 1,7-Diisopropylnaphthalene No suppilers available for the product. |
| Name | 1,7-Diisopropylnaphthalene |
|---|---|
| Synonyms | 1,7-Diisopropylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.33 |
| CAS Registry Number | 94133-80-9 |
| EINECS | 302-743-9 |
| SMILES | C2=C1C(=CC=CC1=CC=C2C(C)C)C(C)C |
| InChI | 1S/C16H20/c1-11(2)14-9-8-13-6-5-7-15(12(3)4)16(13)10-14/h5-12H,1-4H3 |
| InChIKey | XNSUVOOWWSAQMZ-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.805°C at 760 mmHg (Cal.) |
| Flash point | 142.537°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Diisopropylnaphthalene |