|
CAS#: 94133-79-6 Product: 1,2-Bis(Isopropyl)Naphthalene No suppilers available for the product. |
| Name | 1,2-Bis(Isopropyl)Naphthalene |
|---|---|
| Synonyms | 1,2-Diisopropylnaphthalene; 1,2-Bis(Isopropyl)Naphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.33 |
| CAS Registry Number | 94133-79-6 |
| EINECS | 302-742-3 |
| SMILES | C2=CC1=CC=CC=C1C(=C2C(C)C)C(C)C |
| InChI | 1S/C16H20/c1-11(2)14-10-9-13-7-5-6-8-15(13)16(14)12(3)4/h5-12H,1-4H3 |
| InChIKey | IAUKWGFWINVWKS-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.185°C at 760 mmHg (Cal.) |
| Flash point | 138.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(Isopropyl)Naphthalene |