|
CAS#: 94135-71-4 Product: Ethyl N-formyl-L-phenylalanyl-L-phenylalaninate No suppilers available for the product. |
| Name | Ethyl N-formyl-L-phenylalanyl-L-phenylalaninate |
|---|---|
| Synonyms | ethyl N-(N-formyl-3-phenyl-L-alanyl)-3-phenyl-L-alaninate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 |
| CAS Registry Number | 94135-71-4 |
| EINECS | 302-942-0 |
| SMILES | CCOC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC=O)Cc2ccccc2 |
| InChI | 1S/C21H24N2O4/c1-2-27-21(26)19(14-17-11-7-4-8-12-17)23-20(25)18(22-15-24)13-16-9-5-3-6-10-16/h3-12,15,18-19H,2,13-14H2,1H3,(H,22,24)(H,23,25)/t18-,19-/m0/s1 |
| InChIKey | WMNMKMOXKDFVCM-OALUTQOASA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.495°C at 760 mmHg (Cal.) |
| Flash point | 339.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-formyl-L-phenylalanyl-L-phenylalaninate |