|
CAS#: 94149-41-4 Product: Midesteine No suppilers available for the product. |
| Name | Midesteine |
|---|---|
| Synonyms | S-[1-Methyl-2-Oxo-2-[(2-Oxotetrahydrothiophen-3-Yl)Amino]Ethyl] Thiophene-2-Carbothioate; 2-Thiophenecarbothioic Acid S-[1-Methyl-2-Oxo-2-[(2-Oxo-3-Tetrahydrothiophenyl)Amino]Ethyl] Ester; Thiophene-2-Carbothioic Acid S-[2-Keto-2-[(2-Ketotetrahydrothiophen- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO3S3 |
| Molecular Weight | 315.42 |
| CAS Registry Number | 94149-41-4 |
| SMILES | C2=C(C(SC(C(NC1C(SCC1)=O)=O)C)=O)SC=C2 |
| InChI | 1S/C12H13NO3S3/c1-7(19-12(16)9-3-2-5-17-9)10(14)13-8-4-6-18-11(8)15/h2-3,5,7-8H,4,6H2,1H3,(H,13,14) |
| InChIKey | MKTVMEMIKNBVHI-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.254°C at 760 mmHg (Cal.) |
| Flash point | 292.027°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Midesteine |