|
CAS#: 94166-57-1 Product: N-Ethyl-6-Methoxy-3-Nitropyridin-2-Amine No suppilers available for the product. |
| Name | N-Ethyl-6-Methoxy-3-Nitropyridin-2-Amine |
|---|---|
| Synonyms | N-Ethyl-6-Methoxy-3-Nitro-Pyridin-2-Amine; N-Ethyl-6-Methoxy-3-Nitro-2-Pyridinamine; Ethyl-(6-Methoxy-3-Nitro-2-Pyridyl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 94166-57-1 |
| EINECS | 303-353-1 |
| SMILES | C1=C([N+]([O-])=O)C(=NC(=C1)OC)NCC |
| InChI | 1S/C8H11N3O3/c1-3-9-8-6(11(12)13)4-5-7(10-8)14-2/h4-5H,3H2,1-2H3,(H,9,10) |
| InChIKey | ASUQBRULJIRHPC-UHFFFAOYSA-N |
| Density | 1.277g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.357°C at 760 mmHg (Cal.) |
| Flash point | 159.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-6-Methoxy-3-Nitropyridin-2-Amine |