|
CAS#: 94199-71-0 Product: Sodium 6-[Methyl(Phenylsulphonyl)Amino]Hexanoate No suppilers available for the product. |
| Name | Sodium 6-[Methyl(Phenylsulphonyl)Amino]Hexanoate |
|---|---|
| Synonyms | Sodium 6-(Methyl-Phenylsulfonyl-Amino)Hexanoate; Sodium 6-(Methyl(Phenylsulphonyl)Amino)Hexanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18NNaO4S |
| Molecular Weight | 307.34 |
| CAS Registry Number | 94199-71-0 |
| EINECS | 303-445-1 |
| SMILES | C1=C([S](=O)(=O)N(CCCCCC([O-])=O)C)C=CC=C1.[Na+] |
| InChI | 1S/C13H19NO4S.Na/c1-14(11-7-3-6-10-13(15)16)19(17,18)12-8-4-2-5-9-12;/h2,4-5,8-9H,3,6-7,10-11H2,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | UYNVFCVPMFZLSK-UHFFFAOYSA-M |
| Boiling point | 464.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 234.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 6-[Methyl(Phenylsulphonyl)Amino]Hexanoate |