|
CAS#: 94200-15-4 Product: [2-(3,5-dihydroxyphenyl)-2-oxo-ethyl]-isopropyl-ammonium sulfate No suppilers available for the product. |
| Name | [2-(3,5-dihydroxyphenyl)-2-oxo-ethyl]-isopropyl-ammonium sulfate |
|---|---|
| Synonyms | bis[[2-(3 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H32N2O10S |
| Molecular Weight | 516.56 |
| CAS Registry Number | 94200-15-4 |
| EINECS | 303-491-2 |
| SMILES | Oc1cc(cc(O)c1)C(=O)C[NH2+]C(C)C.[O-]S([O-])(=O)=O.CC(C)[NH2+]CC(=O)c1cc(O)cc(O)c1 |
| InChI | 1S/2C11H15NO3.H2O4S/c2*1-7(2)12-6-11(15)8-3-9(13)5-10(14)4-8;1-5(2,3)4/h2*3-5,7,12-14H,6H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | FQWRVSJRQIAPRK-UHFFFAOYSA-N |
| Boiling point | 777.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(3,5-dihydroxyphenyl)-2-oxo-ethyl]-isopropyl-ammonium sulfate |