|
CAS#: 94200-45-0 Product: diammonium (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxy-undecyl) phosphate No suppilers available for the product. |
| Name | diammonium (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxy-undecyl) phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H14F17N2O5P |
| Molecular Weight | 608.19 |
| CAS Registry Number | 94200-45-0 |
| EINECS | 303-523-5 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C11H8F17O5P.2H3N/c12-4(13,1-3(29)2-33-34(30,31)32)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28;;/h3,29H,1-2H2,(H2,30,31,32);2*1H3 |
| InChIKey | AQEVYDYZRHDMFO-UHFFFAOYSA-N |
| Boiling point | 448°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 224.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for diammonium (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-2-hydroxy-undecyl) phosphate |