|
CAS#: 94200-46-1 Product: diammonium (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxy-tridecyl) phosphate No suppilers available for the product. |
| Name | diammonium (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxy-tridecyl) phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F21N2O5P |
| Molecular Weight | 708.20 |
| CAS Registry Number | 94200-46-1 |
| EINECS | 303-524-0 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C13H8F21O5P.2H3N/c14-4(15,1-3(35)2-39-40(36,37)38)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)12(30,31)13(32,33)34;;/h3,35H,1-2H2,(H2,36,37,38);2*1H3 |
| InChIKey | OSCAVMVVXPBMJU-UHFFFAOYSA-N |
| Boiling point | 463.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 233.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for diammonium (4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-hydroxy-tridecyl) phosphate |